C30H28N6O4PtS2 — CID 135506976
bis(N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-N'-phenylcarbamimidothioate);platinum(2+) (PubChem CID 135506976) has the molecular formula C30H28N6O4PtS2 and a molecular weight of 795.80 g/mol. Its IUPAC name is bis(N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-N'-phenylcarbamimidothioate);platinum(2+).
| Compound Name | bis(N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-N'-phenylcarbamimidothioate);platinum(2+) |
|---|---|
| PubChem CID | 135506976 |
| Molecular Formula | C30H28N6O4PtS2 |
| Molecular Weight | 795.80 g/mol |
| Exact Mass | 795.13 |
| IUPAC Name | bis(N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-N'-phenylcarbamimidothioate);platinum(2+) |
| SMILES | COc1cccc(/C=N/N/C([S-])=N/c2ccccc2)c1O.COc1cccc(/C=N/N/C([S-])=N\c2ccccc2)c1O.[Pt+2] |
| InChI | InChI=1S/2C15H15N3O2S.Pt/c2*1-20-13-9-5-6-11(14(13)19)10-16-18-15(21)17-12-7-3-2-4-8-12;/h2*2-10,19H,1H3,(H2,17,18,21);/q;;+2/p-2/b2*16-10+; |
| InChIKey | RDVXILBSRZBOBH-JEFRERBXSA-L |
| XLogP | 5.12 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.80 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|