C16H16ClF3N2O2 — CID 170890970
1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]propan-2-amine (PubChem CID 170890970) has the molecular formula C16H16ClF3N2O2 and a molecular weight of 360.76 g/mol. Its IUPAC name is 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]propan-2-amine.
| Compound Name | 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]propan-2-amine |
|---|---|
| PubChem CID | 170890970 |
| Molecular Formula | C16H16ClF3N2O2 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]propan-2-amine |
| SMILES | COc1cccc(CC(C)N)c1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H16ClF3N2O2/c1-9(21)6-10-4-3-5-13(23-2)14(10)24-15-12(17)7-11(8-22-15)16(18,19)20/h3-5,7-9H,6,21H2,1-2H3 |
| InChIKey | LMKDQMOUMHPZFB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |