C14H10ClF3INO3 — CID 162586671
[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methoxyphenyl]methyl hypoiodite (PubChem CID 162586671) has the molecular formula C14H10ClF3INO3 and a molecular weight of 459.59 g/mol. Its IUPAC name is [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methoxyphenyl]methyl hypoiodite.
| Compound Name | [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methoxyphenyl]methyl hypoiodite |
|---|---|
| PubChem CID | 162586671 |
| Molecular Formula | C14H10ClF3INO3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 458.93 |
| IUPAC Name | [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methoxyphenyl]methyl hypoiodite |
| SMILES | COc1cc(Oc2ncc(C(F)(F)F)cc2Cl)ccc1COI |
| InChI | InChI=1S/C14H10ClF3INO3/c1-21-12-5-10(3-2-8(12)7-22-19)23-13-11(15)4-9(6-20-13)14(16,17)18/h2-6H,7H2,1H3 |
| InChIKey | OHDDRPVITCYWNP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|