C17H12ClF3N2O3S — CID 46216676
5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methylphenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 46216676) has the molecular formula C17H12ClF3N2O3S and a molecular weight of 416.81 g/mol. Its IUPAC name is 5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methylphenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methylphenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 46216676 |
| Molecular Formula | C17H12ClF3N2O3S |
| Molecular Weight | 416.81 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methylphenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(Oc2ncc(C(F)(F)F)cc2Cl)ccc1CC1SC(=O)NC1=O |
| InChI | InChI=1S/C17H12ClF3N2O3S/c1-8-4-11(3-2-9(8)5-13-14(24)23-16(25)27-13)26-15-12(18)6-10(7-22-15)17(19,20)21/h2-4,6-7,13H,5H2,1H3,(H,23,24,25) |
| InChIKey | ZAMASFSDWVSMSY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.81 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|