C24H23ClF3NO4 — CID 90759948
9-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-ethylphenyl]-3-oxaspiro[5.5]undecane-8,10-dione (PubChem CID 90759948) has the molecular formula C24H23ClF3NO4 and a molecular weight of 481.90 g/mol. Its IUPAC name is 9-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-ethylphenyl]-3-oxaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-ethylphenyl]-3-oxaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 90759948 |
| Molecular Formula | C24H23ClF3NO4 |
| Molecular Weight | 481.90 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 9-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-ethylphenyl]-3-oxaspiro[5.5]undecane-8,10-dione |
| SMILES | CCc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1C1C(=O)CC2(CCOCC2)CC1=O |
| InChI | InChI=1S/C24H23ClF3NO4/c1-2-14-3-4-16(33-22-18(25)9-15(13-29-22)24(26,27)28)10-17(14)21-19(30)11-23(12-20(21)31)5-7-32-8-6-23/h3-4,9-10,13,21H,2,5-8,11-12H2,1H3 |
| InChIKey | NQLLGBZVHLOVIL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.90 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|