C15H11ClF3NO4 — CID 22070374
[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl] propaneperoxoate (PubChem CID 22070374) has the molecular formula C15H11ClF3NO4 and a molecular weight of 361.70 g/mol. Its IUPAC name is [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl] propaneperoxoate.
| Compound Name | [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl] propaneperoxoate |
|---|---|
| PubChem CID | 22070374 |
| Molecular Formula | C15H11ClF3NO4 |
| Molecular Weight | 361.70 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl] propaneperoxoate |
| SMILES | CCC(=O)OOc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C15H11ClF3NO4/c1-2-13(21)24-23-11-5-3-10(4-6-11)22-14-12(16)7-9(8-20-14)15(17,18)19/h3-8H,2H2,1H3 |
| InChIKey | BMIRBMJRQFUGQX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|