C18H11ClF3NO2S — CID 139697363
4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]sulfanylphenol (PubChem CID 139697363) has the molecular formula C18H11ClF3NO2S and a molecular weight of 397.81 g/mol. Its IUPAC name is 4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]sulfanylphenol.
| Compound Name | 4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]sulfanylphenol |
|---|---|
| PubChem CID | 139697363 |
| Molecular Formula | C18H11ClF3NO2S |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]sulfanylphenol |
| SMILES | Oc1ccc(Sc2ccc(Oc3ncc(C(F)(F)F)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C18H11ClF3NO2S/c19-16-9-11(18(20,21)22)10-23-17(16)25-13-3-7-15(8-4-13)26-14-5-1-12(24)2-6-14/h1-10,24H |
| InChIKey | NZLULXDPVYVYDI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |