C20H18F3NO5S — CID 143273981
5-[[2-ethoxy-4-[2-(hydroxymethyl)-4-(trifluoromethyl)phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 143273981) has the molecular formula C20H18F3NO5S and a molecular weight of 441.43 g/mol. Its IUPAC name is 5-[[2-ethoxy-4-[2-(hydroxymethyl)-4-(trifluoromethyl)phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-ethoxy-4-[2-(hydroxymethyl)-4-(trifluoromethyl)phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 143273981 |
| Molecular Formula | C20H18F3NO5S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 5-[[2-ethoxy-4-[2-(hydroxymethyl)-4-(trifluoromethyl)phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(Oc2ccc(C(F)(F)F)cc2CO)ccc1CC1SC(=O)NC1=O |
| InChI | InChI=1S/C20H18F3NO5S/c1-2-28-16-9-14(5-3-11(16)8-17-18(26)24-19(27)30-17)29-15-6-4-13(20(21,22)23)7-12(15)10-25/h3-7,9,17,25H,2,8,10H2,1H3,(H,24,26,27) |
| InChIKey | FAECWZZHTBSIJV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|