C8H7F4N3 — CID 22120088
2-[2-fluoro-5-(trifluoromethyl)phenyl]guanidine (PubChem CID 22120088) has the molecular formula C8H7F4N3 and a molecular weight of 221.16 g/mol. Its IUPAC name is 2-[2-fluoro-5-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-[2-fluoro-5-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 22120088 |
| Molecular Formula | C8H7F4N3 |
| Molecular Weight | 221.16 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 2-[2-fluoro-5-(trifluoromethyl)phenyl]guanidine |
| SMILES | NC(N)=Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C8H7F4N3/c9-5-2-1-4(8(10,11)12)3-6(5)15-7(13)14/h1-3H,(H4,13,14,15) |
| InChIKey | PAOYJAIFEPYNRM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|