C11H11F4N3 — CID 178030367
(3Z)-4-[2-fluoro-4-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4-triamine (PubChem CID 178030367) has the molecular formula C11H11F4N3 and a molecular weight of 261.22 g/mol. Its IUPAC name is (3Z)-4-[2-fluoro-4-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4-triamine.
| Compound Name | (3Z)-4-[2-fluoro-4-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 178030367 |
| Molecular Formula | C11H11F4N3 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (3Z)-4-[2-fluoro-4-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4-triamine |
| SMILES | NC(N)=C/C=C(\N)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C11H11F4N3/c12-8-5-6(11(13,14)15)1-2-7(8)9(16)3-4-10(17)18/h1-5H,16-18H2/b9-3- |
| InChIKey | VJZQNKYRIOUTQN-OQFOIZHKSA-N |
| XLogP | 1.90 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|