C9H8F4O3 — CID 171823177
[2-fluoro-4-(trifluoromethyl)phenyl]-methoxymethanediol (PubChem CID 171823177) has the molecular formula C9H8F4O3 and a molecular weight of 240.15 g/mol. Its IUPAC name is [2-fluoro-4-(trifluoromethyl)phenyl]-methoxymethanediol.
| Compound Name | [2-fluoro-4-(trifluoromethyl)phenyl]-methoxymethanediol |
|---|---|
| PubChem CID | 171823177 |
| Molecular Formula | C9H8F4O3 |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | [2-fluoro-4-(trifluoromethyl)phenyl]-methoxymethanediol |
| SMILES | COC(O)(O)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H8F4O3/c1-16-9(14,15)6-3-2-5(4-7(6)10)8(11,12)13/h2-4,14-15H,1H3 |
| InChIKey | GCONGHNGBVBYPU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|