C14H20F3NO2 — CID 103391542
5-amino-1-methoxy-2-[2-methyl-4-(trifluoromethyl)phenyl]pentan-2-ol (PubChem CID 103391542) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 5-amino-1-methoxy-2-[2-methyl-4-(trifluoromethyl)phenyl]pentan-2-ol.
| Compound Name | 5-amino-1-methoxy-2-[2-methyl-4-(trifluoromethyl)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 103391542 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-amino-1-methoxy-2-[2-methyl-4-(trifluoromethyl)phenyl]pentan-2-ol |
| SMILES | COCC(O)(CCCN)c1ccc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C14H20F3NO2/c1-10-8-11(14(15,16)17)4-5-12(10)13(19,9-20-2)6-3-7-18/h4-5,8,19H,3,6-7,9,18H2,1-2H3 |
| InChIKey | JYAZDRRDZXGQSH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |