C14H20F3NO2 — CID 103391368
5-amino-1-methoxy-2-[[3-(trifluoromethyl)phenyl]methyl]pentan-2-ol (PubChem CID 103391368) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 5-amino-1-methoxy-2-[[3-(trifluoromethyl)phenyl]methyl]pentan-2-ol.
| Compound Name | 5-amino-1-methoxy-2-[[3-(trifluoromethyl)phenyl]methyl]pentan-2-ol |
|---|---|
| PubChem CID | 103391368 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-amino-1-methoxy-2-[[3-(trifluoromethyl)phenyl]methyl]pentan-2-ol |
| SMILES | COCC(O)(CCCN)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3NO2/c1-20-10-13(19,6-3-7-18)9-11-4-2-5-12(8-11)14(15,16)17/h2,4-5,8,19H,3,6-7,9-10,18H2,1H3 |
| InChIKey | MUPSOCOPHKJZGQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |