C12H14F3N3S — CID 178030235
(3Z)-4-[3-methylsulfanyl-4-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4-triamine (PubChem CID 178030235) has the molecular formula C12H14F3N3S and a molecular weight of 289.33 g/mol. Its IUPAC name is (3Z)-4-[3-methylsulfanyl-4-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4-triamine.
| Compound Name | (3Z)-4-[3-methylsulfanyl-4-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 178030235 |
| Molecular Formula | C12H14F3N3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (3Z)-4-[3-methylsulfanyl-4-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4-triamine |
| SMILES | CSc1cc(/C(N)=C/C=C(N)N)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3S/c1-19-10-6-7(9(16)4-5-11(17)18)2-3-8(10)12(13,14)15/h2-6H,16-18H2,1H3/b9-4- |
| InChIKey | TUOPMXNIOWFZNM-WTKPLQERSA-N |
| XLogP | 2.49 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|