C12H15F3N4 — CID 162595760
5-(1-amino-3-propan-2-yliminoprop-1-enyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 162595760) has the molecular formula C12H15F3N4 and a molecular weight of 272.27 g/mol. Its IUPAC name is 5-(1-amino-3-propan-2-yliminoprop-1-enyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-(1-amino-3-propan-2-yliminoprop-1-enyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 162595760 |
| Molecular Formula | C12H15F3N4 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 5-(1-amino-3-propan-2-yliminoprop-1-enyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)/N=C/C=C(N)c1cnc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N4/c1-7(2)18-4-3-10(16)8-5-9(12(13,14)15)11(17)19-6-8/h3-7H,16H2,1-2H3,(H2,17,19)/b10-3?,18-4+ |
| InChIKey | WVLRTKABZXBNHF-GWWBNQPWSA-N |
| XLogP | 2.46 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|