C15H17F3N4O — CID 138499373
(1S)-1-[4-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1-but-3-enylimidazol-2-yl]ethanol (PubChem CID 138499373) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is (1S)-1-[4-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1-but-3-enylimidazol-2-yl]ethanol.
| Compound Name | (1S)-1-[4-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1-but-3-enylimidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 138499373 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (1S)-1-[4-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1-but-3-enylimidazol-2-yl]ethanol |
| SMILES | C=CCCn1cc(-c2cnc(N)c(C(F)(F)F)c2)nc1[C@H](C)O |
| InChI | InChI=1S/C15H17F3N4O/c1-3-4-5-22-8-12(21-14(22)9(2)23)10-6-11(15(16,17)18)13(19)20-7-10/h3,6-9,23H,1,4-5H2,2H3,(H2,19,20)/t9-/m0/s1 |
| InChIKey | IHIVVIJADXTNIT-VIFPVBQESA-N |
| XLogP | 3.18 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|