C22H29F3N4 — CID 135349817
5-[1-[5-(1-bicyclo[1.1.1]pentanyl)pentyl]-2-propan-2-ylimidazol-4-yl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 135349817) has the molecular formula C22H29F3N4 and a molecular weight of 406.50 g/mol. Its IUPAC name is 5-[1-[5-(1-bicyclo[1.1.1]pentanyl)pentyl]-2-propan-2-ylimidazol-4-yl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[1-[5-(1-bicyclo[1.1.1]pentanyl)pentyl]-2-propan-2-ylimidazol-4-yl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 135349817 |
| Molecular Formula | C22H29F3N4 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 5-[1-[5-(1-bicyclo[1.1.1]pentanyl)pentyl]-2-propan-2-ylimidazol-4-yl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)c1nc(-c2cnc(N)c(C(F)(F)F)c2)cn1CCCCCC12CC(C1)C2 |
| InChI | InChI=1S/C22H29F3N4/c1-14(2)20-28-18(16-8-17(22(23,24)25)19(26)27-12-16)13-29(20)7-5-3-4-6-21-9-15(10-21)11-21/h8,12-15H,3-7,9-11H2,1-2H3,(H2,26,27) |
| InChIKey | VDZWCRVWOPGBGF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|