C25H35F3N6 — CID 123259696
5-[3-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-3-propan-2-yliminopropanimidoyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 123259696) has the molecular formula C25H35F3N6 and a molecular weight of 476.59 g/mol. Its IUPAC name is 5-[3-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-3-propan-2-yliminopropanimidoyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[3-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-3-propan-2-yliminopropanimidoyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 123259696 |
| Molecular Formula | C25H35F3N6 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 5-[3-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-3-propan-2-yliminopropanimidoyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | [H]/N=C(/C/C(=N/C(C)C)C1C2CC(N3CCN4CCCC4C3)CC21)c1cnc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H35F3N6/c1-14(2)32-22(11-21(29)15-8-20(25(26,27)28)24(30)31-12-15)23-18-9-17(10-19(18)23)34-7-6-33-5-3-4-16(33)13-34/h8,12,14,16-19,23,29H,3-7,9-11,13H2,1-2H3,(H2,30,31)/b29-21-,32-22- |
| InChIKey | KJVAMLIHQNXTHX-OAVCPHEISA-N |
| XLogP | 4.09 |
| TPSA | 81.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|