C23H33F2N5O2 — CID 123427935
5-[3-butan-2-ylimino-3-(3-morpholin-4-yl-6-bicyclo[3.1.0]hexanyl)propanimidoyl]-3-(difluoromethoxy)pyridin-2-amine (PubChem CID 123427935) has the molecular formula C23H33F2N5O2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 5-[3-butan-2-ylimino-3-(3-morpholin-4-yl-6-bicyclo[3.1.0]hexanyl)propanimidoyl]-3-(difluoromethoxy)pyridin-2-amine.
| Compound Name | 5-[3-butan-2-ylimino-3-(3-morpholin-4-yl-6-bicyclo[3.1.0]hexanyl)propanimidoyl]-3-(difluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 123427935 |
| Molecular Formula | C23H33F2N5O2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 5-[3-butan-2-ylimino-3-(3-morpholin-4-yl-6-bicyclo[3.1.0]hexanyl)propanimidoyl]-3-(difluoromethoxy)pyridin-2-amine |
| SMILES | [H]/N=C(/C/C(=N/C(C)CC)C1C2CC(N3CCOCC3)CC21)c1cnc(N)c(OC(F)F)c1 |
| InChI | InChI=1S/C23H33F2N5O2/c1-3-13(2)29-19(11-18(26)14-8-20(32-23(24)25)22(27)28-12-14)21-16-9-15(10-17(16)21)30-4-6-31-7-5-30/h8,12-13,15-17,21,23,26H,3-7,9-11H2,1-2H3,(H2,27,28)/b26-18-,29-19- |
| InChIKey | LRBTXKAMSDYDAV-NLZOFWOISA-N |
| XLogP | 3.62 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|