C13H15F4N — CID 168887293
ethane;N-[(Z)-1-[2-fluoro-4-(trifluoromethyl)phenyl]prop-1-enyl]methanimine (PubChem CID 168887293) has the molecular formula C13H15F4N and a molecular weight of 261.26 g/mol. Its IUPAC name is ethane;N-[(Z)-1-[2-fluoro-4-(trifluoromethyl)phenyl]prop-1-enyl]methanimine.
| Compound Name | ethane;N-[(Z)-1-[2-fluoro-4-(trifluoromethyl)phenyl]prop-1-enyl]methanimine |
|---|---|
| PubChem CID | 168887293 |
| Molecular Formula | C13H15F4N |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | ethane;N-[(Z)-1-[2-fluoro-4-(trifluoromethyl)phenyl]prop-1-enyl]methanimine |
| SMILES | C=N/C(=C\C)c1ccc(C(F)(F)F)cc1F.CC |
| InChI | InChI=1S/C11H9F4N.C2H6/c1-3-10(16-2)8-5-4-7(6-9(8)12)11(13,14)15;1-2/h3-6H,2H2,1H3;1-2H3/b10-3-; |
| InChIKey | HFZNYRHBBQUNAO-HVHUWTQGSA-N |
| XLogP | 4.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|