C14H9BrF4N2O — CID 22347130
N'-(4-bromophenyl)-2-fluoro-N-hydroxy-4-(trifluoromethyl)benzenecarboximidamide (PubChem CID 22347130) has the molecular formula C14H9BrF4N2O and a molecular weight of 377.14 g/mol. Its IUPAC name is N'-(4-bromophenyl)-2-fluoro-N-hydroxy-4-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N'-(4-bromophenyl)-2-fluoro-N-hydroxy-4-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 22347130 |
| Molecular Formula | C14H9BrF4N2O |
| Molecular Weight | 377.14 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | N'-(4-bromophenyl)-2-fluoro-N-hydroxy-4-(trifluoromethyl)benzenecarboximidamide |
| SMILES | ON/C(=N\c1ccc(Br)cc1)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C14H9BrF4N2O/c15-9-2-4-10(5-3-9)20-13(21-22)11-6-1-8(7-12(11)16)14(17,18)19/h1-7,22H,(H,20,21) |
| InChIKey | FYLJDPIOLSLKNY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.14 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|