About N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide
N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide (PubChem CID 175196993) has the molecular formula C8H4Br2F3N
and a molecular weight of 330.93 g/mol. Its IUPAC name is N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide |
| PubChem CID | 175196993 |
| Molecular Formula | C8H4Br2F3N |
| Molecular Weight | 330.93 g/mol |
| Exact Mass | 328.87 |
| IUPAC Name | N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide |
| SMILES | FC(F)(F)/C(Br)=N/c1ccc(Br)cc1 |
| InChI | InChI=1S/C8H4Br2F3N/c9-5-1-3-6(4-2-5)14-7(10)8(11,12)13/h1-4H/b14-7- |
| InChIKey | ISSXUPUQLCGDOL-AUWJEWJLSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide?
The IUPAC name of N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide (CID 175196993) is N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide.
What is the SMILES notation for N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide?
The canonical SMILES for N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide is FC(F)(F)/C(Br)=N/c1ccc(Br)cc1.
What is the InChIKey of N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide?
The InChIKey is ISSXUPUQLCGDOL-AUWJEWJLSA-N. The full InChI is InChI=1S/C8H4Br2F3N/c9-5-1-3-6(4-2-5)14-7(10)8(11,12)13/h1-4H/b14-7-.
What are the key properties of N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide?
N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide has a molecular weight of 330.93 g/mol, XLogP of 4.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-2,2,2-trifluoroethanimidoyl bromide is sourced from PubChem (CID 175196993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).