C19H15F7N2O — CID 129271791
2-fluoro-N'-hydroxy-N-methyl-4-(trifluoromethyl)-N-[(Z)-1-[4-(trifluoromethyl)phenyl]prop-1-enyl]benzenecarboximidamide (PubChem CID 129271791) has the molecular formula C19H15F7N2O and a molecular weight of 420.33 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-N-methyl-4-(trifluoromethyl)-N-[(Z)-1-[4-(trifluoromethyl)phenyl]prop-1-enyl]benzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-N-methyl-4-(trifluoromethyl)-N-[(Z)-1-[4-(trifluoromethyl)phenyl]prop-1-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 129271791 |
| Molecular Formula | C19H15F7N2O |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-fluoro-N'-hydroxy-N-methyl-4-(trifluoromethyl)-N-[(Z)-1-[4-(trifluoromethyl)phenyl]prop-1-enyl]benzenecarboximidamide |
| SMILES | C/C=C(/c1ccc(C(F)(F)F)cc1)N(C)/C(=N/O)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C19H15F7N2O/c1-3-16(11-4-6-12(7-5-11)18(21,22)23)28(2)17(27-29)14-9-8-13(10-15(14)20)19(24,25)26/h3-10,29H,1-2H3/b16-3-,27-17+ |
| InChIKey | MHNYYVOUTPEPAR-WPFADJKESA-N |
| XLogP | 5.99 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|