C13H12F4 — CID 135178558
2-fluoro-1-(1-prop-1-en-2-ylcyclopropyl)-4-(trifluoromethyl)benzene (PubChem CID 135178558) has the molecular formula C13H12F4 and a molecular weight of 244.23 g/mol. Its IUPAC name is 2-fluoro-1-(1-prop-1-en-2-ylcyclopropyl)-4-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-1-(1-prop-1-en-2-ylcyclopropyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 135178558 |
| Molecular Formula | C13H12F4 |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-fluoro-1-(1-prop-1-en-2-ylcyclopropyl)-4-(trifluoromethyl)benzene |
| SMILES | C=C(C)C1(c2ccc(C(F)(F)F)cc2F)CC1 |
| InChI | InChI=1S/C13H12F4/c1-8(2)12(5-6-12)10-4-3-9(7-11(10)14)13(15,16)17/h3-4,7H,1,5-6H2,2H3 |
| InChIKey | CLWZXOPGVAVNPU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|