C15H16F4OS — CID 171963724
3-[2-fluoro-4-(trifluoromethyl)phenyl]-9-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171963724) has the molecular formula C15H16F4OS and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-[2-fluoro-4-(trifluoromethyl)phenyl]-9-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-[2-fluoro-4-(trifluoromethyl)phenyl]-9-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171963724 |
| Molecular Formula | C15H16F4OS |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-[2-fluoro-4-(trifluoromethyl)phenyl]-9-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | OC1(c2ccc(C(F)(F)F)cc2F)CC2CCCC(C1)S2 |
| InChI | InChI=1S/C15H16F4OS/c16-13-6-9(15(17,18)19)4-5-12(13)14(20)7-10-2-1-3-11(8-14)21-10/h4-6,10-11,20H,1-3,7-8H2 |
| InChIKey | ITUQJAJLBYOUBN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |