C15H16FNOS — CID 171960782
4-fluoro-2-(3-hydroxy-9-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile (PubChem CID 171960782) has the molecular formula C15H16FNOS and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-fluoro-2-(3-hydroxy-9-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile.
| Compound Name | 4-fluoro-2-(3-hydroxy-9-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile |
|---|---|
| PubChem CID | 171960782 |
| Molecular Formula | C15H16FNOS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-fluoro-2-(3-hydroxy-9-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile |
| SMILES | N#Cc1ccc(F)cc1C1(O)CC2CCCC(C1)S2 |
| InChI | InChI=1S/C15H16FNOS/c16-11-5-4-10(9-17)14(6-11)15(18)7-12-2-1-3-13(8-15)19-12/h4-6,12-13,18H,1-3,7-8H2 |
| InChIKey | LVWHUZKIPPEWSD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |