C15H17NOS — CID 171960423
2-(3-hydroxy-8-thiabicyclo[3.2.1]octan-3-yl)-4-methylbenzonitrile (PubChem CID 171960423) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 2-(3-hydroxy-8-thiabicyclo[3.2.1]octan-3-yl)-4-methylbenzonitrile.
| Compound Name | 2-(3-hydroxy-8-thiabicyclo[3.2.1]octan-3-yl)-4-methylbenzonitrile |
|---|---|
| PubChem CID | 171960423 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-(3-hydroxy-8-thiabicyclo[3.2.1]octan-3-yl)-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)c(C2(O)CC3CCC(C2)S3)c1 |
| InChI | InChI=1S/C15H17NOS/c1-10-2-3-11(9-16)14(6-10)15(17)7-12-4-5-13(8-15)18-12/h2-3,6,12-13,17H,4-5,7-8H2,1H3 |
| InChIKey | COLGCYGZMVAGGH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |