C16H22O2S — CID 171961327
3-(2-ethoxyphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171961327) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(2-ethoxyphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171961327 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-(2-ethoxyphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | CCOc1ccccc1C1(O)CC2CCCC(C1)S2 |
| InChI | InChI=1S/C16H22O2S/c1-2-18-15-9-4-3-8-14(15)16(17)10-12-6-5-7-13(11-16)19-12/h3-4,8-9,12-13,17H,2,5-7,10-11H2,1H3 |
| InChIKey | KJCPOFGRZUODKB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |