C18H24O2 — CID 62800401
8-(2-ethoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol (PubChem CID 62800401) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 8-(2-ethoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol.
| Compound Name | 8-(2-ethoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol |
|---|---|
| PubChem CID | 62800401 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 8-(2-ethoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol |
| SMILES | CCOc1ccccc1C1(O)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C18H24O2/c1-2-20-17-9-4-3-8-15(17)18(19)11-12-10-16(18)14-7-5-6-13(12)14/h3-4,8-9,12-14,16,19H,2,5-7,10-11H2,1H3 |
| InChIKey | IBOMGUSFCMNNPM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |