C17H21ClO2 — CID 62788709
8-(5-chloro-2-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol (PubChem CID 62788709) has the molecular formula C17H21ClO2 and a molecular weight of 292.81 g/mol. Its IUPAC name is 8-(5-chloro-2-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol.
| Compound Name | 8-(5-chloro-2-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol |
|---|---|
| PubChem CID | 62788709 |
| Molecular Formula | C17H21ClO2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 8-(5-chloro-2-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol |
| SMILES | COc1ccc(Cl)cc1C1(O)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H21ClO2/c1-20-16-6-5-11(18)8-15(16)17(19)9-10-7-14(17)13-4-2-3-12(10)13/h5-6,8,10,12-14,19H,2-4,7,9H2,1H3 |
| InChIKey | XBFJUSMKJOEOKG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |