C15H19FO2S — CID 171955112
3-(2-ethoxy-5-fluorophenyl)-8-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171955112) has the molecular formula C15H19FO2S and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-(2-ethoxy-5-fluorophenyl)-8-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(2-ethoxy-5-fluorophenyl)-8-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171955112 |
| Molecular Formula | C15H19FO2S |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-(2-ethoxy-5-fluorophenyl)-8-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | CCOc1ccc(F)cc1C1(O)CC2CCC(C1)S2 |
| InChI | InChI=1S/C15H19FO2S/c1-2-18-14-6-3-10(16)7-13(14)15(17)8-11-4-5-12(9-15)19-11/h3,6-7,11-12,17H,2,4-5,8-9H2,1H3 |
| InChIKey | YHLOCTBSNLCCJU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |