C14H8F6O2 — CID 168528391
1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone (PubChem CID 168528391) has the molecular formula C14H8F6O2 and a molecular weight of 322.20 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 168528391 |
| Molecular Formula | C14H8F6O2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone |
| SMILES | CC(=O)c1c(-c2ccco2)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H8F6O2/c1-7(21)12-9(11-3-2-4-22-11)5-8(13(15,16)17)6-10(12)14(18,19)20/h2-6H,1H3 |
| InChIKey | KYNPNJUWJJKBKV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |