About 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone
1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone (PubChem CID 168528391) has the molecular formula C14H8F6O2
and a molecular weight of 322.20 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone |
| PubChem CID | 168528391 |
| Molecular Formula | C14H8F6O2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone |
| SMILES | CC(=O)c1c(-c2ccco2)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H8F6O2/c1-7(21)12-9(11-3-2-4-22-11)5-8(13(15,16)17)6-10(12)14(18,19)20/h2-6H,1H3 |
| InChIKey | KYNPNJUWJJKBKV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone?
The IUPAC name of 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone (CID 168528391) is 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone.
What is the SMILES notation for 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone?
The canonical SMILES for 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone is CC(=O)c1c(-c2ccco2)cc(C(F)(F)F)cc1C(F)(F)F.
What is the InChIKey of 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone?
The InChIKey is KYNPNJUWJJKBKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F6O2/c1-7(21)12-9(11-3-2-4-22-11)5-8(13(15,16)17)6-10(12)14(18,19)20/h2-6H,1H3.
What are the key properties of 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone?
1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone has a molecular weight of 322.20 g/mol, XLogP of 5.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(furan-2-yl)-4,6-bis(trifluoromethyl)phenyl]ethanone is sourced from PubChem (CID 168528391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).