C8H8F3N5 — CID 168600515
1-(diaminomethylidene)-2-(2,4,5-trifluorophenyl)guanidine (PubChem CID 168600515) has the molecular formula C8H8F3N5 and a molecular weight of 231.18 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(2,4,5-trifluorophenyl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(2,4,5-trifluorophenyl)guanidine |
|---|---|
| PubChem CID | 168600515 |
| Molecular Formula | C8H8F3N5 |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 1-(diaminomethylidene)-2-(2,4,5-trifluorophenyl)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C8H8F3N5/c9-3-1-5(11)6(2-4(3)10)15-8(14)16-7(12)13/h1-2H,(H6,12,13,14,15,16) |
| InChIKey | PEINZZQZWQIUQS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|