C9H8F5N5O3S — CID 168605666
[5-[[amino-(diaminomethylideneamino)methylidene]amino]-2,4-difluorophenyl] trifluoromethanesulfonate (PubChem CID 168605666) has the molecular formula C9H8F5N5O3S and a molecular weight of 361.25 g/mol. Its IUPAC name is [5-[[amino-(diaminomethylideneamino)methylidene]amino]-2,4-difluorophenyl] trifluoromethanesulfonate.
| Compound Name | [5-[[amino-(diaminomethylideneamino)methylidene]amino]-2,4-difluorophenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 168605666 |
| Molecular Formula | C9H8F5N5O3S |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | [5-[[amino-(diaminomethylideneamino)methylidene]amino]-2,4-difluorophenyl] trifluoromethanesulfonate |
| SMILES | NC(N)=N/C(N)=N/c1cc(OS(=O)(=O)C(F)(F)F)c(F)cc1F |
| InChI | InChI=1S/C9H8F5N5O3S/c10-3-1-4(11)6(22-23(20,21)9(12,13)14)2-5(3)18-8(17)19-7(15)16/h1-2H,(H6,15,16,17,18,19) |
| InChIKey | DDXSIYUKLWHDLM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|