C14H13F2N5 — CID 168602848
1-(diaminomethylidene)-2-[2-(3,4-difluorophenyl)phenyl]guanidine (PubChem CID 168602848) has the molecular formula C14H13F2N5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(3,4-difluorophenyl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(3,4-difluorophenyl)phenyl]guanidine |
|---|---|
| PubChem CID | 168602848 |
| Molecular Formula | C14H13F2N5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(3,4-difluorophenyl)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccccc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H13F2N5/c15-10-6-5-8(7-11(10)16)9-3-1-2-4-12(9)20-14(19)21-13(17)18/h1-7H,(H6,17,18,19,20,21) |
| InChIKey | BGICRCIVDQCHGT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|