C28H16Cl2F9N3O2 — CID 167145578
4-cyano-N-(cyclopropylmethyl)-N-[5-[[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]-2-fluorobenzamide (PubChem CID 167145578) has the molecular formula C28H16Cl2F9N3O2 and a molecular weight of 668.34 g/mol. Its IUPAC name is 4-cyano-N-(cyclopropylmethyl)-N-[5-[[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]-2-fluorobenzamide.
| Compound Name | 4-cyano-N-(cyclopropylmethyl)-N-[5-[[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 167145578 |
| Molecular Formula | C28H16Cl2F9N3O2 |
| Molecular Weight | 668.34 g/mol |
| Exact Mass | 667.05 |
| IUPAC Name | 4-cyano-N-(cyclopropylmethyl)-N-[5-[[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]-2-fluorobenzamide |
| SMILES | N#Cc1ccc(C(=O)N(CC2CC2)c2cc(C(=O)Nc3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3Cl)ccc2F)c(F)c1 |
| InChI | InChI=1S/C28H16Cl2F9N3O2/c29-18-9-16(26(33,27(34,35)36)28(37,38)39)10-19(30)23(18)41-24(43)15-4-6-20(31)22(8-15)42(12-13-1-2-13)25(44)17-5-3-14(11-40)7-21(17)32/h3-10,13H,1-2,12H2,(H,41,43) |
| InChIKey | UGVDPBQISVBTGT-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.34 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |