C20H13Cl2F7N4O3 — CID 118665862
[5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methyl-3-pyridinyl] ethyl carbonate (PubChem CID 118665862) has the molecular formula C20H13Cl2F7N4O3 and a molecular weight of 561.24 g/mol. Its IUPAC name is [5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methyl-3-pyridinyl] ethyl carbonate.
| Compound Name | [5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methyl-3-pyridinyl] ethyl carbonate |
|---|---|
| PubChem CID | 118665862 |
| Molecular Formula | C20H13Cl2F7N4O3 |
| Molecular Weight | 561.24 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | [5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methyl-3-pyridinyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc(-c2cn(-c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3Cl)nn2)cnc1C |
| InChI | InChI=1S/C20H13Cl2F7N4O3/c1-3-35-17(34)36-15-4-10(7-30-9(15)2)14-8-33(32-31-14)16-12(21)5-11(6-13(16)22)18(23,19(24,25)26)20(27,28)29/h4-8H,3H2,1-2H3 |
| InChIKey | OCKHGAPNTFEMQJ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.24 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |