C29H24ClF7N4 — CID 150207801
4-(4-aminophenyl)-5-chloro-N-cyclopropyl-2-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]pyrazol-4-yl]aniline (PubChem CID 150207801) has the molecular formula C29H24ClF7N4 and a molecular weight of 596.98 g/mol. Its IUPAC name is 4-(4-aminophenyl)-5-chloro-N-cyclopropyl-2-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]pyrazol-4-yl]aniline.
| Compound Name | 4-(4-aminophenyl)-5-chloro-N-cyclopropyl-2-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]pyrazol-4-yl]aniline |
|---|---|
| PubChem CID | 150207801 |
| Molecular Formula | C29H24ClF7N4 |
| Molecular Weight | 596.98 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 4-(4-aminophenyl)-5-chloro-N-cyclopropyl-2-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]pyrazol-4-yl]aniline |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1-n1cc(-c2cc(-c3ccc(N)cc3)c(Cl)cc2NC2CC2)cn1 |
| InChI | InChI=1S/C29H24ClF7N4/c1-15-9-19(27(31,28(32,33)34)29(35,36)37)10-16(2)26(15)41-14-18(13-39-41)23-11-22(17-3-5-20(38)6-4-17)24(30)12-25(23)40-21-7-8-21/h3-6,9-14,21,40H,7-8,38H2,1-2H3 |
| InChIKey | FQVNKRFRCSQGSS-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.98 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|