C16H14N4O2 — CID 71988285
pyridin-2-ylmethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate (PubChem CID 71988285) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate.
| Compound Name | pyridin-2-ylmethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 71988285 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | pyridin-2-ylmethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate |
| SMILES | Cc1cc(-n2cncn2)ccc1C(=O)OCc1ccccn1 |
| InChI | InChI=1S/C16H14N4O2/c1-12-8-14(20-11-17-10-19-20)5-6-15(12)16(21)22-9-13-4-2-3-7-18-13/h2-8,10-11H,9H2,1H3 |
| InChIKey | YUYHTILICOMTIR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |