C26H21F7N2O5S — CID 87361726
[1,1,1,3,3,3-hexafluoro-2-[4-[[3-[(4-fluorobenzoyl)amino]benzoyl]amino]-3,5-dimethylphenyl]propan-2-yl] methanesulfonate (PubChem CID 87361726) has the molecular formula C26H21F7N2O5S and a molecular weight of 606.52 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-[[3-[(4-fluorobenzoyl)amino]benzoyl]amino]-3,5-dimethylphenyl]propan-2-yl] methanesulfonate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-[[3-[(4-fluorobenzoyl)amino]benzoyl]amino]-3,5-dimethylphenyl]propan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 87361726 |
| Molecular Formula | C26H21F7N2O5S |
| Molecular Weight | 606.52 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-[[3-[(4-fluorobenzoyl)amino]benzoyl]amino]-3,5-dimethylphenyl]propan-2-yl] methanesulfonate |
| SMILES | Cc1cc(C(OS(C)(=O)=O)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1cccc(NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H21F7N2O5S/c1-14-11-18(24(25(28,29)30,26(31,32)33)40-41(3,38)39)12-15(2)21(14)35-23(37)17-5-4-6-20(13-17)34-22(36)16-7-9-19(27)10-8-16/h4-13H,1-3H3,(H,34,36)(H,35,37) |
| InChIKey | LRODSBSNQLEJOL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|