C23H20F4N2O2 — CID 59497816
3-amino-N-[2,6-dimethyl-4-[2,2,2-trifluoro-1-(4-fluorophenyl)-1-hydroxyethyl]phenyl]benzamide (PubChem CID 59497816) has the molecular formula C23H20F4N2O2 and a molecular weight of 432.42 g/mol. Its IUPAC name is 3-amino-N-[2,6-dimethyl-4-[2,2,2-trifluoro-1-(4-fluorophenyl)-1-hydroxyethyl]phenyl]benzamide.
| Compound Name | 3-amino-N-[2,6-dimethyl-4-[2,2,2-trifluoro-1-(4-fluorophenyl)-1-hydroxyethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 59497816 |
| Molecular Formula | C23H20F4N2O2 |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-amino-N-[2,6-dimethyl-4-[2,2,2-trifluoro-1-(4-fluorophenyl)-1-hydroxyethyl]phenyl]benzamide |
| SMILES | Cc1cc(C(O)(c2ccc(F)cc2)C(F)(F)F)cc(C)c1NC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C23H20F4N2O2/c1-13-10-17(22(31,23(25,26)27)16-6-8-18(24)9-7-16)11-14(2)20(13)29-21(30)15-4-3-5-19(28)12-15/h3-12,31H,28H2,1-2H3,(H,29,30) |
| InChIKey | QVRSNJQBAMUTPT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|