C23H15Br2F7N2O2S — CID 140519952
3-benzamido-N-[2-[dibromo(1,1,2,2,3,3,3-heptafluoropropyl)-λ4-sulfanyl]phenyl]benzamide (PubChem CID 140519952) has the molecular formula C23H15Br2F7N2O2S and a molecular weight of 676.25 g/mol. Its IUPAC name is 3-benzamido-N-[2-[dibromo(1,1,2,2,3,3,3-heptafluoropropyl)-λ4-sulfanyl]phenyl]benzamide.
| Compound Name | 3-benzamido-N-[2-[dibromo(1,1,2,2,3,3,3-heptafluoropropyl)-λ4-sulfanyl]phenyl]benzamide |
|---|---|
| PubChem CID | 140519952 |
| Molecular Formula | C23H15Br2F7N2O2S |
| Molecular Weight | 676.25 g/mol |
| Exact Mass | 673.91 |
| IUPAC Name | 3-benzamido-N-[2-[dibromo(1,1,2,2,3,3,3-heptafluoropropyl)-λ4-sulfanyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2ccccc2S(Br)(Br)C(F)(F)C(F)(F)C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C23H15Br2F7N2O2S/c24-37(25,23(31,32)21(26,27)22(28,29)30)18-12-5-4-11-17(18)34-20(36)15-9-6-10-16(13-15)33-19(35)14-7-2-1-3-8-14/h1-13H,(H,33,35)(H,34,36) |
| InChIKey | XAKLQCOGNUSOGY-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.25 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|