C19H13BrF12N2OS — CID 140535149
N-[2-[bromo-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-(1,1,2,2,2-pentafluoroethyl)-λ4-sulfanyl]phenyl]-3-(methylamino)benzamide (PubChem CID 140535149) has the molecular formula C19H13BrF12N2OS and a molecular weight of 625.27 g/mol. Its IUPAC name is N-[2-[bromo-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-(1,1,2,2,2-pentafluoroethyl)-λ4-sulfanyl]phenyl]-3-(methylamino)benzamide.
| Compound Name | N-[2-[bromo-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-(1,1,2,2,2-pentafluoroethyl)-λ4-sulfanyl]phenyl]-3-(methylamino)benzamide |
|---|---|
| PubChem CID | 140535149 |
| Molecular Formula | C19H13BrF12N2OS |
| Molecular Weight | 625.27 g/mol |
| Exact Mass | 623.97 |
| IUPAC Name | N-[2-[bromo-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-(1,1,2,2,2-pentafluoroethyl)-λ4-sulfanyl]phenyl]-3-(methylamino)benzamide |
| SMILES | CNc1cccc(C(=O)Nc2ccccc2S(Br)(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13BrF12N2OS/c1-33-11-6-4-5-10(9-11)14(35)34-12-7-2-3-8-13(12)36(20,19(31,32)18(28,29)30)15(21,16(22,23)24)17(25,26)27/h2-9,33H,1H3,(H,34,35) |
| InChIKey | LUZAZURMVHDXNX-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.27 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|