C22H20F7IN2O3S — CID 74401022
1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(1-methylsulfinylpropan-2-yl)benzene-1,2-dicarboxamide (PubChem CID 74401022) has the molecular formula C22H20F7IN2O3S and a molecular weight of 652.37 g/mol. Its IUPAC name is 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(1-methylsulfinylpropan-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(1-methylsulfinylpropan-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 74401022 |
| Molecular Formula | C22H20F7IN2O3S |
| Molecular Weight | 652.37 g/mol |
| Exact Mass | 652.01 |
| IUPAC Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(1-methylsulfinylpropan-2-yl)benzene-1,2-dicarboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1cccc(I)c1C(=O)NC(C)CS(C)=O |
| InChI | InChI=1S/C22H20F7IN2O3S/c1-11-9-13(20(23,21(24,25)26)22(27,28)29)7-8-16(11)32-18(33)14-5-4-6-15(30)17(14)19(34)31-12(2)10-36(3)35/h4-9,12H,10H2,1-3H3,(H,31,34)(H,32,33) |
| InChIKey | DTVYHYFLVXOYAR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|