C23H22Br2F6N2O2S — CID 11693180
3-bromo-1-N-[4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-2-N-[(2S)-1-ethylsulfanylpropan-2-yl]benzene-1,2-dicarboxamide (PubChem CID 11693180) has the molecular formula C23H22Br2F6N2O2S and a molecular weight of 664.30 g/mol. Its IUPAC name is 3-bromo-1-N-[4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-2-N-[(2S)-1-ethylsulfanylpropan-2-yl]benzene-1,2-dicarboxamide.
| Compound Name | 3-bromo-1-N-[4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-2-N-[(2S)-1-ethylsulfanylpropan-2-yl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 11693180 |
| Molecular Formula | C23H22Br2F6N2O2S |
| Molecular Weight | 664.30 g/mol |
| Exact Mass | 661.97 |
| IUPAC Name | 3-bromo-1-N-[4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-2-N-[(2S)-1-ethylsulfanylpropan-2-yl]benzene-1,2-dicarboxamide |
| SMILES | CCSC[C@H](C)NC(=O)c1c(Br)cccc1C(=O)Nc1ccc(C(F)(C(F)(F)F)C(F)(F)Br)cc1C |
| InChI | InChI=1S/C23H22Br2F6N2O2S/c1-4-36-11-13(3)32-20(35)18-15(6-5-7-16(18)24)19(34)33-17-9-8-14(10-12(17)2)21(26,22(25,27)28)23(29,30)31/h5-10,13H,4,11H2,1-3H3,(H,32,35)(H,33,34)/t13-,21?/m0/s1 |
| InChIKey | ZRHCXGLARRMVCE-JRTLGTJJSA-N |
| XLogP | 7.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.30 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|