C22H20Cl2F6N2O2S — CID 11534189
3-chloro-1-N-[2-chloro-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenyl]-2-N-[(2S)-1-ethylsulfanylpropan-2-yl]benzene-1,2-dicarboxamide (PubChem CID 11534189) has the molecular formula C22H20Cl2F6N2O2S and a molecular weight of 561.38 g/mol. Its IUPAC name is 3-chloro-1-N-[2-chloro-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenyl]-2-N-[(2S)-1-ethylsulfanylpropan-2-yl]benzene-1,2-dicarboxamide.
| Compound Name | 3-chloro-1-N-[2-chloro-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenyl]-2-N-[(2S)-1-ethylsulfanylpropan-2-yl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 11534189 |
| Molecular Formula | C22H20Cl2F6N2O2S |
| Molecular Weight | 561.38 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | 3-chloro-1-N-[2-chloro-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenyl]-2-N-[(2S)-1-ethylsulfanylpropan-2-yl]benzene-1,2-dicarboxamide |
| SMILES | CCSC[C@H](C)NC(=O)c1c(Cl)cccc1C(=O)Nc1ccc(C(F)(C(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C22H20Cl2F6N2O2S/c1-3-35-10-11(2)31-19(34)17-13(5-4-6-14(17)23)18(33)32-16-8-7-12(9-15(16)24)21(27,20(25)26)22(28,29)30/h4-9,11,20H,3,10H2,1-2H3,(H,31,34)(H,32,33)/t11-,21?/m0/s1 |
| InChIKey | WSXJCPPHZWIUPV-QHIQZGGMSA-N |
| XLogP | 7.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.38 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |