C15H23ClN2O2SSi — CID 91439213
3-chloro-1-N-[1-(trimethylsilylmethylsulfanyl)propan-2-yl]benzene-1,2-dicarboxamide (PubChem CID 91439213) has the molecular formula C15H23ClN2O2SSi and a molecular weight of 358.97 g/mol. Its IUPAC name is 3-chloro-1-N-[1-(trimethylsilylmethylsulfanyl)propan-2-yl]benzene-1,2-dicarboxamide.
| Compound Name | 3-chloro-1-N-[1-(trimethylsilylmethylsulfanyl)propan-2-yl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 91439213 |
| Molecular Formula | C15H23ClN2O2SSi |
| Molecular Weight | 358.97 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 3-chloro-1-N-[1-(trimethylsilylmethylsulfanyl)propan-2-yl]benzene-1,2-dicarboxamide |
| SMILES | CC(CSC[Si](C)(C)C)NC(=O)c1cccc(Cl)c1C(N)=O |
| InChI | InChI=1S/C15H23ClN2O2SSi/c1-10(8-21-9-22(2,3)4)18-15(20)11-6-5-7-12(16)13(11)14(17)19/h5-7,10H,8-9H2,1-4H3,(H2,17,19)(H,18,20) |
| InChIKey | QUHBWTLRRBHYBJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.97 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|