C14H22ClNOSi — CID 18630255
N-butan-2-yl-2-chloro-6-trimethylsilylbenzamide (PubChem CID 18630255) has the molecular formula C14H22ClNOSi and a molecular weight of 283.88 g/mol. Its IUPAC name is N-butan-2-yl-2-chloro-6-trimethylsilylbenzamide.
| Compound Name | N-butan-2-yl-2-chloro-6-trimethylsilylbenzamide |
|---|---|
| PubChem CID | 18630255 |
| Molecular Formula | C14H22ClNOSi |
| Molecular Weight | 283.88 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-butan-2-yl-2-chloro-6-trimethylsilylbenzamide |
| SMILES | CCC(C)NC(=O)c1c(Cl)cccc1[Si](C)(C)C |
| InChI | InChI=1S/C14H22ClNOSi/c1-6-10(2)16-14(17)13-11(15)8-7-9-12(13)18(3,4)5/h7-10H,6H2,1-5H3,(H,16,17) |
| InChIKey | QDROCUHHLBWHCP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.88 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|