C22H30Cl2NO5PSi2 — CID 67614861
[(2-chloro-6-trimethylsilylbenzoyl)oxy-(ethylamino)phosphoryl] 2-chloro-6-trimethylsilylbenzoate (PubChem CID 67614861) has the molecular formula C22H30Cl2NO5PSi2 and a molecular weight of 546.54 g/mol. Its IUPAC name is [(2-chloro-6-trimethylsilylbenzoyl)oxy-(ethylamino)phosphoryl] 2-chloro-6-trimethylsilylbenzoate.
| Compound Name | [(2-chloro-6-trimethylsilylbenzoyl)oxy-(ethylamino)phosphoryl] 2-chloro-6-trimethylsilylbenzoate |
|---|---|
| PubChem CID | 67614861 |
| Molecular Formula | C22H30Cl2NO5PSi2 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | [(2-chloro-6-trimethylsilylbenzoyl)oxy-(ethylamino)phosphoryl] 2-chloro-6-trimethylsilylbenzoate |
| SMILES | CCNP(=O)(OC(=O)c1c(Cl)cccc1[Si](C)(C)C)OC(=O)c1c(Cl)cccc1[Si](C)(C)C |
| InChI | InChI=1S/C22H30Cl2NO5PSi2/c1-8-25-31(28,29-21(26)19-15(23)11-9-13-17(19)32(2,3)4)30-22(27)20-16(24)12-10-14-18(20)33(5,6)7/h9-14H,8H2,1-7H3,(H,25,28) |
| InChIKey | QLKDTSRSMQGQKP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|