C13H18ClNOSi — CID 18630326
2-chloro-N-prop-2-enyl-6-trimethylsilylbenzamide (PubChem CID 18630326) has the molecular formula C13H18ClNOSi and a molecular weight of 267.83 g/mol. Its IUPAC name is 2-chloro-N-prop-2-enyl-6-trimethylsilylbenzamide.
| Compound Name | 2-chloro-N-prop-2-enyl-6-trimethylsilylbenzamide |
|---|---|
| PubChem CID | 18630326 |
| Molecular Formula | C13H18ClNOSi |
| Molecular Weight | 267.83 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-chloro-N-prop-2-enyl-6-trimethylsilylbenzamide |
| SMILES | C=CCNC(=O)c1c(Cl)cccc1[Si](C)(C)C |
| InChI | InChI=1S/C13H18ClNOSi/c1-5-9-15-13(16)12-10(14)7-6-8-11(12)17(2,3)4/h5-8H,1,9H2,2-4H3,(H,15,16) |
| InChIKey | JKWYBJWFROXYEI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.83 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|